C14H15FO5S — CID 172716484
2-(4-fluorophenyl)sulfonyl-2-(3-oxocyclohexyl)acetic acid (PubChem CID 172716484) has the molecular formula C14H15FO5S and a molecular weight of 314.33 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfonyl-2-(3-oxocyclohexyl)acetic acid.
| Compound Name | 2-(4-fluorophenyl)sulfonyl-2-(3-oxocyclohexyl)acetic acid |
|---|---|
| PubChem CID | 172716484 |
| Molecular Formula | C14H15FO5S |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2-(4-fluorophenyl)sulfonyl-2-(3-oxocyclohexyl)acetic acid |
| SMILES | O=C1CCCC(C(C(=O)O)S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C14H15FO5S/c15-10-4-6-12(7-5-10)21(19,20)13(14(17)18)9-2-1-3-11(16)8-9/h4-7,9,13H,1-3,8H2,(H,17,18) |
| InChIKey | FXVQKSYSDOMGOF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |