C32H45IO7S — CID 10327384
ethyl (2S,4E,6E,10E)-2-[(4R,6S)-6-[3-(benzenesulfonyl)-2-oxopropyl]-2,2-dimethyl-1,3-dioxan-4-yl]-12-iodo-2,5,11-trimethyldodeca-4,6,10-trienoate (PubChem CID 10327384) has the molecular formula C32H45IO7S and a molecular weight of 700.68 g/mol. Its IUPAC name is ethyl (2S,4E,6E,10E)-2-[(4R,6S)-6-[3-(benzenesulfonyl)-2-oxopropyl]-2,2-dimethyl-1,3-dioxan-4-yl]-12-iodo-2,5,11-trimethyldodeca-4,6,10-trienoate.
| Compound Name | ethyl (2S,4E,6E,10E)-2-[(4R,6S)-6-[3-(benzenesulfonyl)-2-oxopropyl]-2,2-dimethyl-1,3-dioxan-4-yl]-12-iodo-2,5,11-trimethyldodeca-4,6,10-trienoate |
|---|---|
| PubChem CID | 10327384 |
| Molecular Formula | C32H45IO7S |
| Molecular Weight | 700.68 g/mol |
| Exact Mass | 700.19 |
| IUPAC Name | ethyl (2S,4E,6E,10E)-2-[(4R,6S)-6-[3-(benzenesulfonyl)-2-oxopropyl]-2,2-dimethyl-1,3-dioxan-4-yl]-12-iodo-2,5,11-trimethyldodeca-4,6,10-trienoate |
| SMILES | CCOC(=O)[C@@](C)(C/C=C(C)/C=C/CC/C=C(\C)CI)[C@H]1C[C@@H](CC(=O)CS(=O)(=O)c2ccccc2)OC(C)(C)O1 |
| InChI | InChI=1S/C32H45IO7S/c1-7-38-30(35)32(6,19-18-24(2)14-10-8-11-15-25(3)22-33)29-21-27(39-31(4,5)40-29)20-26(34)23-41(36,37)28-16-12-9-13-17-28/h9-10,12-18,27,29H,7-8,11,19-23H2,1-6H3/b14-10+,24-18+,25-15+/t27-,29-,32+/m1/s1 |
| InChIKey | KQQDPLWRBKJJJG-CTCAAXPVSA-N |
| XLogP | 6.95 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.68 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|