C38H64O6S — CID 54402686
tert-butyl (2S,3S,5R)-3-hydroxy-2-[(S)-(4-methylphenyl)sulfinyl]-5-(oxan-2-yloxy)docos-13-enoate (PubChem CID 54402686) has the molecular formula C38H64O6S and a molecular weight of 648.99 g/mol. Its IUPAC name is tert-butyl (2S,3S,5R)-3-hydroxy-2-[(S)-(4-methylphenyl)sulfinyl]-5-(oxan-2-yloxy)docos-13-enoate.
| Compound Name | tert-butyl (2S,3S,5R)-3-hydroxy-2-[(S)-(4-methylphenyl)sulfinyl]-5-(oxan-2-yloxy)docos-13-enoate |
|---|---|
| PubChem CID | 54402686 |
| Molecular Formula | C38H64O6S |
| Molecular Weight | 648.99 g/mol |
| Exact Mass | 648.44 |
| IUPAC Name | tert-butyl (2S,3S,5R)-3-hydroxy-2-[(S)-(4-methylphenyl)sulfinyl]-5-(oxan-2-yloxy)docos-13-enoate |
| SMILES | CCCCCCCCC=CCCCCCCC[C@H](C[C@H](O)[C@@H](C(=O)OC(C)(C)C)[S@](=O)c1ccc(C)cc1)OC1CCCCO1 |
| InChI | InChI=1S/C38H64O6S/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-32(43-35-24-21-22-29-42-35)30-34(39)36(37(40)44-38(3,4)5)45(41)33-27-25-31(2)26-28-33/h13-14,25-28,32,34-36,39H,6-12,15-24,29-30H2,1-5H3/t32-,34+,35?,36+,45-/m1/s1 |
| InChIKey | VONWJLLZBXVMFO-VFQPRVGKSA-N |
| XLogP | 9.51 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.99 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|