C22H34O5S — CID 23256306
ethyl (2S)-5-ethoxy-2-[(1S,2S)-1-hydroxy-2-(4-methylphenyl)sulfinylcyclohexyl]pentanoate (PubChem CID 23256306) has the molecular formula C22H34O5S and a molecular weight of 410.58 g/mol. Its IUPAC name is ethyl (2S)-5-ethoxy-2-[(1S,2S)-1-hydroxy-2-(4-methylphenyl)sulfinylcyclohexyl]pentanoate.
| Compound Name | ethyl (2S)-5-ethoxy-2-[(1S,2S)-1-hydroxy-2-(4-methylphenyl)sulfinylcyclohexyl]pentanoate |
|---|---|
| PubChem CID | 23256306 |
| Molecular Formula | C22H34O5S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | ethyl (2S)-5-ethoxy-2-[(1S,2S)-1-hydroxy-2-(4-methylphenyl)sulfinylcyclohexyl]pentanoate |
| SMILES | CCOCCC[C@H](C(=O)OCC)[C@@]1(O)CCCC[C@@H]1S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H34O5S/c1-4-26-16-8-9-19(21(23)27-5-2)22(24)15-7-6-10-20(22)28(25)18-13-11-17(3)12-14-18/h11-14,19-20,24H,4-10,15-16H2,1-3H3/t19-,20+,22+,28?/m1/s1 |
| InChIKey | BTRJIFLAWSLCFX-ASBLNRPKSA-N |
| XLogP | 3.77 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|