C24H38O8S — CID 14543163
methyl 3-hydroxy-2-[(4-methylphenyl)sulfonyloxymethyl]-10-(oxan-2-yloxy)decanoate (PubChem CID 14543163) has the molecular formula C24H38O8S and a molecular weight of 486.63 g/mol. Its IUPAC name is methyl 3-hydroxy-2-[(4-methylphenyl)sulfonyloxymethyl]-10-(oxan-2-yloxy)decanoate.
| Compound Name | methyl 3-hydroxy-2-[(4-methylphenyl)sulfonyloxymethyl]-10-(oxan-2-yloxy)decanoate |
|---|---|
| PubChem CID | 14543163 |
| Molecular Formula | C24H38O8S |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | methyl 3-hydroxy-2-[(4-methylphenyl)sulfonyloxymethyl]-10-(oxan-2-yloxy)decanoate |
| SMILES | COC(=O)C(COS(=O)(=O)c1ccc(C)cc1)C(O)CCCCCCCOC1CCCCO1 |
| InChI | InChI=1S/C24H38O8S/c1-19-12-14-20(15-13-19)33(27,28)32-18-21(24(26)29-2)22(25)10-6-4-3-5-8-16-30-23-11-7-9-17-31-23/h12-15,21-23,25H,3-11,16-18H2,1-2H3 |
| InChIKey | BDEMSGPCVZPPIL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|