C29H40O13S2 — CID 44607429
[(2R)-3-(4-methylphenyl)sulfonyloxy-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(4-methylphenyl)sulfonyloxymethyl]oxan-2-yl]oxypropyl] hexanoate (PubChem CID 44607429) has the molecular formula C29H40O13S2 and a molecular weight of 660.76 g/mol. Its IUPAC name is [(2R)-3-(4-methylphenyl)sulfonyloxy-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(4-methylphenyl)sulfonyloxymethyl]oxan-2-yl]oxypropyl] hexanoate.
| Compound Name | [(2R)-3-(4-methylphenyl)sulfonyloxy-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(4-methylphenyl)sulfonyloxymethyl]oxan-2-yl]oxypropyl] hexanoate |
|---|---|
| PubChem CID | 44607429 |
| Molecular Formula | C29H40O13S2 |
| Molecular Weight | 660.76 g/mol |
| Exact Mass | 660.19 |
| IUPAC Name | [(2R)-3-(4-methylphenyl)sulfonyloxy-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(4-methylphenyl)sulfonyloxymethyl]oxan-2-yl]oxypropyl] hexanoate |
| SMILES | CCCCCC(=O)OC[C@H](COS(=O)(=O)c1ccc(C)cc1)O[C@@H]1O[C@H](COS(=O)(=O)c2ccc(C)cc2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C29H40O13S2/c1-4-5-6-7-25(30)38-16-21(17-39-43(34,35)22-12-8-19(2)9-13-22)41-29-28(33)27(32)26(31)24(42-29)18-40-44(36,37)23-14-10-20(3)11-15-23/h8-15,21,24,26-29,31-33H,4-7,16-18H2,1-3H3/t21-,24-,26-,27+,28-,29-/m1/s1 |
| InChIKey | LFEBKLRQESKAED-QAJOSVNBSA-N |
| XLogP | 1.73 |
| TPSA | 192.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.76 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|