C16H22O6S — CID 138968512
ethyl 2-[(2R,4S)-4-(4-methylphenyl)sulfonyloxyoxan-2-yl]acetate (PubChem CID 138968512) has the molecular formula C16H22O6S and a molecular weight of 342.41 g/mol. Its IUPAC name is ethyl 2-[(2R,4S)-4-(4-methylphenyl)sulfonyloxyoxan-2-yl]acetate.
| Compound Name | ethyl 2-[(2R,4S)-4-(4-methylphenyl)sulfonyloxyoxan-2-yl]acetate |
|---|---|
| PubChem CID | 138968512 |
| Molecular Formula | C16H22O6S |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | ethyl 2-[(2R,4S)-4-(4-methylphenyl)sulfonyloxyoxan-2-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1C[C@@H](OS(=O)(=O)c2ccc(C)cc2)CCO1 |
| InChI | InChI=1S/C16H22O6S/c1-3-20-16(17)11-14-10-13(8-9-21-14)22-23(18,19)15-6-4-12(2)5-7-15/h4-7,13-14H,3,8-11H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | ZTHGRXVNBAWKAJ-UONOGXRCSA-N |
| XLogP | 2.20 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|