C32H44O7S — CID 10008266
ethyl (1R,2S,4E,6E,10E,16S)-13-(benzenesulfonyl)-2,5,11,18,18-pentamethyl-14-oxo-17,19-dioxabicyclo[14.3.1]icosa-4,6,10-triene-2-carboxylate (PubChem CID 10008266) has the molecular formula C32H44O7S and a molecular weight of 572.76 g/mol. Its IUPAC name is ethyl (1R,2S,4E,6E,10E,16S)-13-(benzenesulfonyl)-2,5,11,18,18-pentamethyl-14-oxo-17,19-dioxabicyclo[14.3.1]icosa-4,6,10-triene-2-carboxylate.
| Compound Name | ethyl (1R,2S,4E,6E,10E,16S)-13-(benzenesulfonyl)-2,5,11,18,18-pentamethyl-14-oxo-17,19-dioxabicyclo[14.3.1]icosa-4,6,10-triene-2-carboxylate |
|---|---|
| PubChem CID | 10008266 |
| Molecular Formula | C32H44O7S |
| Molecular Weight | 572.76 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | ethyl (1R,2S,4E,6E,10E,16S)-13-(benzenesulfonyl)-2,5,11,18,18-pentamethyl-14-oxo-17,19-dioxabicyclo[14.3.1]icosa-4,6,10-triene-2-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C)C/C=C(C)/C=C/CC/C=C(\C)CC(S(=O)(=O)c2ccccc2)C(=O)C[C@@H]2C[C@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C32H44O7S/c1-7-37-30(34)32(6)19-18-23(2)14-10-8-11-15-24(3)20-28(40(35,36)26-16-12-9-13-17-26)27(33)21-25-22-29(32)39-31(4,5)38-25/h9-10,12-18,25,28-29H,7-8,11,19-22H2,1-6H3/b14-10+,23-18+,24-15+/t25-,28?,29-,32+/m1/s1 |
| InChIKey | DCGKSVWNOOIDGP-WYCQCXMQSA-N |
| XLogP | 6.29 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.76 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|