C18H20O4S — CID 15473260
2-(benzenesulfonyl)-1-[(1R,2R,5R,6S)-1,6-dimethyl-9-oxatricyclo[4.2.1.02,5]non-7-en-2-yl]ethanone (PubChem CID 15473260) has the molecular formula C18H20O4S and a molecular weight of 332.42 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-[(1R,2R,5R,6S)-1,6-dimethyl-9-oxatricyclo[4.2.1.02,5]non-7-en-2-yl]ethanone.
| Compound Name | 2-(benzenesulfonyl)-1-[(1R,2R,5R,6S)-1,6-dimethyl-9-oxatricyclo[4.2.1.02,5]non-7-en-2-yl]ethanone |
|---|---|
| PubChem CID | 15473260 |
| Molecular Formula | C18H20O4S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-(benzenesulfonyl)-1-[(1R,2R,5R,6S)-1,6-dimethyl-9-oxatricyclo[4.2.1.02,5]non-7-en-2-yl]ethanone |
| SMILES | C[C@]12C=C[C@](C)(O1)[C@@H]1CC[C@@]12C(=O)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H20O4S/c1-16-10-11-17(2,22-16)18(9-8-14(16)18)15(19)12-23(20,21)13-6-4-3-5-7-13/h3-7,10-11,14H,8-9,12H2,1-2H3/t14-,16-,17+,18-/m0/s1 |
| InChIKey | KLHLLJNIXVFIAG-OWLYRPNTSA-N |
| XLogP | 2.54 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|