C28H51IO4Si2 — CID 134949103
(4S,5S,6S)-4-[(2E,4E,6S,7S,8Z)-6-[tert-butyl(dimethyl)silyl]oxy-9-iodo-5,7-dimethylnona-2,4,8-trienyl]-6-ethyl-5-methyl-4-trimethylsilyloxyoxan-2-one (PubChem CID 134949103) has the molecular formula C28H51IO4Si2 and a molecular weight of 634.79 g/mol. Its IUPAC name is (4S,5S,6S)-4-[(2E,4E,6S,7S,8Z)-6-[tert-butyl(dimethyl)silyl]oxy-9-iodo-5,7-dimethylnona-2,4,8-trienyl]-6-ethyl-5-methyl-4-trimethylsilyloxyoxan-2-one.
| Compound Name | (4S,5S,6S)-4-[(2E,4E,6S,7S,8Z)-6-[tert-butyl(dimethyl)silyl]oxy-9-iodo-5,7-dimethylnona-2,4,8-trienyl]-6-ethyl-5-methyl-4-trimethylsilyloxyoxan-2-one |
|---|---|
| PubChem CID | 134949103 |
| Molecular Formula | C28H51IO4Si2 |
| Molecular Weight | 634.79 g/mol |
| Exact Mass | 634.24 |
| IUPAC Name | (4S,5S,6S)-4-[(2E,4E,6S,7S,8Z)-6-[tert-butyl(dimethyl)silyl]oxy-9-iodo-5,7-dimethylnona-2,4,8-trienyl]-6-ethyl-5-methyl-4-trimethylsilyloxyoxan-2-one |
| SMILES | CC[C@@H]1OC(=O)C[C@](C/C=C/C=C(\C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C\I)(O[Si](C)(C)C)[C@H]1C |
| InChI | InChI=1S/C28H51IO4Si2/c1-13-24-23(4)28(20-25(30)31-24,33-34(8,9)10)18-15-14-16-21(2)26(22(3)17-19-29)32-35(11,12)27(5,6)7/h14-17,19,22-24,26H,13,18,20H2,1-12H3/b15-14+,19-17-,21-16+/t22-,23-,24-,26+,28-/m0/s1 |
| InChIKey | UGUDILLTSCFHME-NNURSYKZSA-N |
| XLogP | 8.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.79 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|