C20H20O3 — CID 134949481
methyl (3aS,4R,8bR)-3a-hydroxy-4-phenyl-1,2,3,8b-tetrahydrocyclopenta[a]indene-4-carboxylate (PubChem CID 134949481) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is methyl (3aS,4R,8bR)-3a-hydroxy-4-phenyl-1,2,3,8b-tetrahydrocyclopenta[a]indene-4-carboxylate.
| Compound Name | methyl (3aS,4R,8bR)-3a-hydroxy-4-phenyl-1,2,3,8b-tetrahydrocyclopenta[a]indene-4-carboxylate |
|---|---|
| PubChem CID | 134949481 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | methyl (3aS,4R,8bR)-3a-hydroxy-4-phenyl-1,2,3,8b-tetrahydrocyclopenta[a]indene-4-carboxylate |
| SMILES | COC(=O)[C@]1(c2ccccc2)c2ccccc2[C@H]2CCC[C@]21O |
| InChI | InChI=1S/C20H20O3/c1-23-18(21)20(14-8-3-2-4-9-14)17-11-6-5-10-15(17)16-12-7-13-19(16,20)22/h2-6,8-11,16,22H,7,12-13H2,1H3/t16-,19+,20+/m1/s1 |
| InChIKey | HFCHWLGALYELRO-UXPWSPDFSA-N |
| XLogP | 3.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |