C20H25NO3 — CID 134949508
methyl (2S,3R)-2-(benzhydrylamino)-3-hydroxy-4-methylpentanoate (PubChem CID 134949508) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is methyl (2S,3R)-2-(benzhydrylamino)-3-hydroxy-4-methylpentanoate.
| Compound Name | methyl (2S,3R)-2-(benzhydrylamino)-3-hydroxy-4-methylpentanoate |
|---|---|
| PubChem CID | 134949508 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | methyl (2S,3R)-2-(benzhydrylamino)-3-hydroxy-4-methylpentanoate |
| SMILES | COC(=O)[C@@H](NC(c1ccccc1)c1ccccc1)[C@H](O)C(C)C |
| InChI | InChI=1S/C20H25NO3/c1-14(2)19(22)18(20(23)24-3)21-17(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-14,17-19,21-22H,1-3H3/t18-,19+/m0/s1 |
| InChIKey | SKWFTDPYBDXTJG-RBUKOAKNSA-N |
| XLogP | 2.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |