C21H27NO3 — CID 134949510
methyl (2S,3R)-2-(benzhydrylamino)-3-hydroxy-4,4-dimethylpentanoate (PubChem CID 134949510) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is methyl (2S,3R)-2-(benzhydrylamino)-3-hydroxy-4,4-dimethylpentanoate.
| Compound Name | methyl (2S,3R)-2-(benzhydrylamino)-3-hydroxy-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 134949510 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | methyl (2S,3R)-2-(benzhydrylamino)-3-hydroxy-4,4-dimethylpentanoate |
| SMILES | COC(=O)[C@@H](NC(c1ccccc1)c1ccccc1)[C@H](O)C(C)(C)C |
| InChI | InChI=1S/C21H27NO3/c1-21(2,3)19(23)18(20(24)25-4)22-17(15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14,17-19,22-23H,1-4H3/t18-,19-/m0/s1 |
| InChIKey | WZWDTGXNQUEXKP-OALUTQOASA-N |
| XLogP | 3.31 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |