C26H27NO2 — CID 134950348
methyl (E,2S)-2-(N-ethylanilino)-2,5-diphenylpent-4-enoate (PubChem CID 134950348) has the molecular formula C26H27NO2 and a molecular weight of 385.51 g/mol. Its IUPAC name is methyl (E,2S)-2-(N-ethylanilino)-2,5-diphenylpent-4-enoate.
| Compound Name | methyl (E,2S)-2-(N-ethylanilino)-2,5-diphenylpent-4-enoate |
|---|---|
| PubChem CID | 134950348 |
| Molecular Formula | C26H27NO2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | methyl (E,2S)-2-(N-ethylanilino)-2,5-diphenylpent-4-enoate |
| SMILES | CCN(c1ccccc1)[C@](C/C=C/c1ccccc1)(C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C26H27NO2/c1-3-27(24-19-11-6-12-20-24)26(25(28)29-2,23-17-9-5-10-18-23)21-13-16-22-14-7-4-8-15-22/h4-20H,3,21H2,1-2H3/b16-13+/t26-/m0/s1 |
| InChIKey | NLMCNRAKMFVDTB-KWAUPFKJSA-N |
| XLogP | 5.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |