C19H29FO4Si — CID 134950416
(3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-3-methyl-5-(phenylmethoxymethyl)oxolan-2-one (PubChem CID 134950416) has the molecular formula C19H29FO4Si and a molecular weight of 368.52 g/mol. Its IUPAC name is (3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-3-methyl-5-(phenylmethoxymethyl)oxolan-2-one.
| Compound Name | (3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-3-methyl-5-(phenylmethoxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 134950416 |
| Molecular Formula | C19H29FO4Si |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | (3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-3-methyl-5-(phenylmethoxymethyl)oxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](COCc2ccccc2)OC(=O)[C@]1(C)F |
| InChI | InChI=1S/C19H29FO4Si/c1-18(2,3)25(5,6)24-16-15(23-17(21)19(16,4)20)13-22-12-14-10-8-7-9-11-14/h7-11,15-16H,12-13H2,1-6H3/t15-,16-,19-/m1/s1 |
| InChIKey | SBNPODUBXKOSDN-GPMSIDNRSA-N |
| XLogP | 4.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|