C21H33FO5Si — CID 134950417
[(3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-3-methyl-5-(phenylmethoxymethyl)oxolan-2-yl] acetate (PubChem CID 134950417) has the molecular formula C21H33FO5Si and a molecular weight of 412.57 g/mol. Its IUPAC name is [(3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-3-methyl-5-(phenylmethoxymethyl)oxolan-2-yl] acetate.
| Compound Name | [(3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-3-methyl-5-(phenylmethoxymethyl)oxolan-2-yl] acetate |
|---|---|
| PubChem CID | 134950417 |
| Molecular Formula | C21H33FO5Si |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | [(3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-3-methyl-5-(phenylmethoxymethyl)oxolan-2-yl] acetate |
| SMILES | CC(=O)OC1O[C@H](COCc2ccccc2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]1(C)F |
| InChI | InChI=1S/C21H33FO5Si/c1-15(23)25-19-21(5,22)18(27-28(6,7)20(2,3)4)17(26-19)14-24-13-16-11-9-8-10-12-16/h8-12,17-19H,13-14H2,1-7H3/t17-,18-,19?,21-/m1/s1 |
| InChIKey | CEMQPUWEFZTXEH-KNLKJWTQSA-N |
| XLogP | 4.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|