C22H21NO — CID 134950461
(1R)-3-benzylimino-1,3-diphenylpropan-1-ol (PubChem CID 134950461) has the molecular formula C22H21NO and a molecular weight of 315.42 g/mol. Its IUPAC name is (1R)-3-benzylimino-1,3-diphenylpropan-1-ol.
| Compound Name | (1R)-3-benzylimino-1,3-diphenylpropan-1-ol |
|---|---|
| PubChem CID | 134950461 |
| Molecular Formula | C22H21NO |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (1R)-3-benzylimino-1,3-diphenylpropan-1-ol |
| SMILES | O[C@H](C/C(=N\Cc1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21NO/c24-22(20-14-8-3-9-15-20)16-21(19-12-6-2-7-13-19)23-17-18-10-4-1-5-11-18/h1-15,22,24H,16-17H2/b23-21+/t22-/m1/s1 |
| InChIKey | LBZMYBXWYWRAKE-HOGKFDNTSA-N |
| XLogP | 4.80 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|