C16H28O5 — CID 134950481
(2S,3S,6S)-6-cyclohexyloxy-3-(2-methoxyethoxymethoxy)-2-methyl-3,6-dihydro-2H-pyran (PubChem CID 134950481) has the molecular formula C16H28O5 and a molecular weight of 300.40 g/mol. Its IUPAC name is (2S,3S,6S)-6-cyclohexyloxy-3-(2-methoxyethoxymethoxy)-2-methyl-3,6-dihydro-2H-pyran.
| Compound Name | (2S,3S,6S)-6-cyclohexyloxy-3-(2-methoxyethoxymethoxy)-2-methyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 134950481 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | (2S,3S,6S)-6-cyclohexyloxy-3-(2-methoxyethoxymethoxy)-2-methyl-3,6-dihydro-2H-pyran |
| SMILES | COCCOCO[C@H]1C=C[C@@H](OC2CCCCC2)O[C@H]1C |
| InChI | InChI=1S/C16H28O5/c1-13-15(19-12-18-11-10-17-2)8-9-16(20-13)21-14-6-4-3-5-7-14/h8-9,13-16H,3-7,10-12H2,1-2H3/t13-,15-,16+/m0/s1 |
| InChIKey | XFWWBXJUQTZUTH-CWRNSKLLSA-N |
| XLogP | 2.64 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|