C23H44B2O4 — CID 134950873
4,4,5,5-tetramethyl-2-[(Z)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)undec-2-en-3-yl]-1,3,2-dioxaborolane (PubChem CID 134950873) has the molecular formula C23H44B2O4 and a molecular weight of 406.23 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(Z)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)undec-2-en-3-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(Z)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)undec-2-en-3-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 134950873 |
| Molecular Formula | C23H44B2O4 |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 406.34 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(Z)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)undec-2-en-3-yl]-1,3,2-dioxaborolane |
| SMILES | CCCCCCCC/C(B1OC(C)(C)C(C)(C)O1)=C(\C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C23H44B2O4/c1-11-12-13-14-15-16-17-19(25-28-22(7,8)23(9,10)29-25)18(2)24-26-20(3,4)21(5,6)27-24/h11-17H2,1-10H3/b19-18- |
| InChIKey | VMHQSVNRCHVJPP-HNENSFHCSA-N |
| XLogP | 6.32 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|