C24H44B2O4 — CID 134904107
4,4,5,5-tetramethyl-2-[(5E,7E)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dodeca-5,7-dien-6-yl]-1,3,2-dioxaborolane (PubChem CID 134904107) has the molecular formula C24H44B2O4 and a molecular weight of 418.24 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(5E,7E)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dodeca-5,7-dien-6-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(5E,7E)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dodeca-5,7-dien-6-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 134904107 |
| Molecular Formula | C24H44B2O4 |
| Molecular Weight | 418.24 g/mol |
| Exact Mass | 418.34 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(5E,7E)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dodeca-5,7-dien-6-yl]-1,3,2-dioxaborolane |
| SMILES | CCCC/C=C(B1OC(C)(C)C(C)(C)O1)/C(=C/CCCC)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C24H44B2O4/c1-11-13-15-17-19(25-27-21(3,4)22(5,6)28-25)20(18-16-14-12-2)26-29-23(7,8)24(9,10)30-26/h17-18H,11-16H2,1-10H3/b19-17-,20-18- |
| InChIKey | ICNFUSBVOLFBEB-CLFAGFIQSA-N |
| XLogP | 6.48 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.24 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|