C26H48B2O4 — CID 134903709
4,4,5,5-tetramethyl-2-[(E,1E)-1-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexylidene]oct-2-enyl]-1,3,2-dioxaborolane (PubChem CID 134903709) has the molecular formula C26H48B2O4 and a molecular weight of 446.29 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(E,1E)-1-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexylidene]oct-2-enyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(E,1E)-1-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexylidene]oct-2-enyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 134903709 |
| Molecular Formula | C26H48B2O4 |
| Molecular Weight | 446.29 g/mol |
| Exact Mass | 446.37 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(E,1E)-1-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexylidene]oct-2-enyl]-1,3,2-dioxaborolane |
| SMILES | CCCCC/C=C/C(B1OC(C)(C)C(C)(C)O1)=C(/CCCCC)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C26H48B2O4/c1-11-13-15-16-18-20-22(28-31-25(7,8)26(9,10)32-28)21(19-17-14-12-2)27-29-23(3,4)24(5,6)30-27/h18,20H,11-17,19H2,1-10H3/b20-18+,22-21+ |
| InChIKey | KEYLHUNQWAQALX-GFBXTXNRSA-N |
| XLogP | 7.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.29 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|