C20H37BO2 — CID 15253342
4,4,5,5-tetramethyl-2-[(5E,7E)-tetradeca-5,7-dien-5-yl]-1,3,2-dioxaborolane (PubChem CID 15253342) has the molecular formula C20H37BO2 and a molecular weight of 320.33 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(5E,7E)-tetradeca-5,7-dien-5-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(5E,7E)-tetradeca-5,7-dien-5-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 15253342 |
| Molecular Formula | C20H37BO2 |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.29 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(5E,7E)-tetradeca-5,7-dien-5-yl]-1,3,2-dioxaborolane |
| SMILES | CCCCCC/C=C/C=C(/CCCC)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H37BO2/c1-7-9-11-12-13-14-15-17-18(16-10-8-2)21-22-19(3,4)20(5,6)23-21/h14-15,17H,7-13,16H2,1-6H3/b15-14+,18-17- |
| InChIKey | LBLDHVDNGGFHEQ-BAKDLITESA-N |
| XLogP | 6.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|