C7H14O2 — CID 134950887
2-[(2R,3R)-3-methyloxolan-2-yl]ethanol (PubChem CID 134950887) has the molecular formula C7H14O2 and a molecular weight of 130.19 g/mol. Its IUPAC name is 2-[(2R,3R)-3-methyloxolan-2-yl]ethanol.
| Compound Name | 2-[(2R,3R)-3-methyloxolan-2-yl]ethanol |
|---|---|
| PubChem CID | 134950887 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | 2-[(2R,3R)-3-methyloxolan-2-yl]ethanol |
| SMILES | C[C@@H]1CCO[C@@H]1CCO |
| InChI | InChI=1S/C7H14O2/c1-6-3-5-9-7(6)2-4-8/h6-8H,2-5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | JHDSJZQUTVBWSR-RNFRBKRXSA-N |
| XLogP | 0.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |