C6H11BrO — CID 155905802
(2R,3S)-2-(bromomethyl)-3-methyloxolane (PubChem CID 155905802) has the molecular formula C6H11BrO and a molecular weight of 179.06 g/mol. Its IUPAC name is (2R,3S)-2-(bromomethyl)-3-methyloxolane.
| Compound Name | (2R,3S)-2-(bromomethyl)-3-methyloxolane |
|---|---|
| PubChem CID | 155905802 |
| Molecular Formula | C6H11BrO |
| Molecular Weight | 179.06 g/mol |
| Exact Mass | 178.00 |
| IUPAC Name | (2R,3S)-2-(bromomethyl)-3-methyloxolane |
| SMILES | C[C@H]1CCO[C@H]1CBr |
| InChI | InChI=1S/C6H11BrO/c1-5-2-3-8-6(5)4-7/h5-6H,2-4H2,1H3/t5-,6-/m0/s1 |
| InChIKey | UYAUKJPGWASXGX-WDSKDSINSA-N |
| XLogP | 1.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.06 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|