About ethane;2-ethyl-3-methyloxane
ethane;2-ethyl-3-methyloxane (PubChem CID 166536348) has the molecular formula C10H22O
and a molecular weight of 158.28 g/mol. Its IUPAC name is ethane;2-ethyl-3-methyloxane.
Molecular Properties
| Compound Name | ethane;2-ethyl-3-methyloxane |
| PubChem CID | 166536348 |
| Molecular Formula | C10H22O |
| Molecular Weight | 158.28 g/mol |
| Exact Mass | 158.17 |
| IUPAC Name | ethane;2-ethyl-3-methyloxane |
| SMILES | CC.CCC1OCCCC1C |
| InChI | InChI=1S/C8H16O.C2H6/c1-3-8-7(2)5-4-6-9-8;1-2/h7-8H,3-6H2,1-2H3;1-2H3 |
| InChIKey | YZVFVDDMKLVLPJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-ethyl-3-methyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethyl-3-methyloxane?
The IUPAC name of ethane;2-ethyl-3-methyloxane (CID 166536348) is ethane;2-ethyl-3-methyloxane.
What is the SMILES notation for ethane;2-ethyl-3-methyloxane?
The canonical SMILES for ethane;2-ethyl-3-methyloxane is CC.CCC1OCCCC1C.
What is the InChIKey of ethane;2-ethyl-3-methyloxane?
The InChIKey is YZVFVDDMKLVLPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.C2H6/c1-3-8-7(2)5-4-6-9-8;1-2/h7-8H,3-6H2,1-2H3;1-2H3.
What are the key properties of ethane;2-ethyl-3-methyloxane?
ethane;2-ethyl-3-methyloxane has a molecular weight of 158.28 g/mol, XLogP of 3.24, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethyl-3-methyloxane is sourced from PubChem (CID 166536348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).