C17H24F3NO2 — CID 134951266
N-[(S)-methoxy-[2-(4,4,4-trifluorobutyl)phenyl]methyl]-2,2-dimethylpropanamide (PubChem CID 134951266) has the molecular formula C17H24F3NO2 and a molecular weight of 331.38 g/mol. Its IUPAC name is N-[(S)-methoxy-[2-(4,4,4-trifluorobutyl)phenyl]methyl]-2,2-dimethylpropanamide.
| Compound Name | N-[(S)-methoxy-[2-(4,4,4-trifluorobutyl)phenyl]methyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 134951266 |
| Molecular Formula | C17H24F3NO2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | N-[(S)-methoxy-[2-(4,4,4-trifluorobutyl)phenyl]methyl]-2,2-dimethylpropanamide |
| SMILES | CO[C@H](NC(=O)C(C)(C)C)c1ccccc1CCCC(F)(F)F |
| InChI | InChI=1S/C17H24F3NO2/c1-16(2,3)15(22)21-14(23-4)13-10-6-5-8-12(13)9-7-11-17(18,19)20/h5-6,8,10,14H,7,9,11H2,1-4H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | IYBFVSGKMVXVGP-AWEZNQCLSA-N |
| XLogP | 4.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|