C20H22F3NO2 — CID 134951267
N-[(S)-methoxy-[2-(4,4,4-trifluoro-2-methylbutyl)phenyl]methyl]benzamide (PubChem CID 134951267) has the molecular formula C20H22F3NO2 and a molecular weight of 365.40 g/mol. Its IUPAC name is N-[(S)-methoxy-[2-(4,4,4-trifluoro-2-methylbutyl)phenyl]methyl]benzamide.
| Compound Name | N-[(S)-methoxy-[2-(4,4,4-trifluoro-2-methylbutyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 134951267 |
| Molecular Formula | C20H22F3NO2 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-[(S)-methoxy-[2-(4,4,4-trifluoro-2-methylbutyl)phenyl]methyl]benzamide |
| SMILES | CO[C@H](NC(=O)c1ccccc1)c1ccccc1CC(C)CC(F)(F)F |
| InChI | InChI=1S/C20H22F3NO2/c1-14(13-20(21,22)23)12-16-10-6-7-11-17(16)19(26-2)24-18(25)15-8-4-3-5-9-15/h3-11,14,19H,12-13H2,1-2H3,(H,24,25)/t14?,19-/m0/s1 |
| InChIKey | RZNOGXAMRHXEPW-PKDNWHCCSA-N |
| XLogP | 4.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|