C38H31F6N3O3 — CID 134951489
3-[3,5-bis(trifluoromethyl)anilino]-4-[[(2S)-3,3-dimethyl-1-oxo-1-[(2R)-2-pyren-4-ylpyrrolidin-1-yl]butan-2-yl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 134951489) has the molecular formula C38H31F6N3O3 and a molecular weight of 691.67 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)anilino]-4-[[(2S)-3,3-dimethyl-1-oxo-1-[(2R)-2-pyren-4-ylpyrrolidin-1-yl]butan-2-yl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[3,5-bis(trifluoromethyl)anilino]-4-[[(2S)-3,3-dimethyl-1-oxo-1-[(2R)-2-pyren-4-ylpyrrolidin-1-yl]butan-2-yl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 134951489 |
| Molecular Formula | C38H31F6N3O3 |
| Molecular Weight | 691.67 g/mol |
| Exact Mass | 691.23 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)anilino]-4-[[(2S)-3,3-dimethyl-1-oxo-1-[(2R)-2-pyren-4-ylpyrrolidin-1-yl]butan-2-yl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | CC(C)(C)[C@H](Nc1c(Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(=O)c1=O)C(=O)N1CCC[C@@H]1c1cc2cccc3ccc4cccc1c4c32 |
| InChI | InChI=1S/C38H31F6N3O3/c1-36(2,3)34(46-31-30(32(48)33(31)49)45-24-17-22(37(39,40)41)16-23(18-24)38(42,43)44)35(50)47-14-6-11-27(47)26-15-21-9-4-7-19-12-13-20-8-5-10-25(26)29(20)28(19)21/h4-5,7-10,12-13,15-18,27,34,45-46H,6,11,14H2,1-3H3/t27-,34-/m1/s1 |
| InChIKey | HYVLAOBYZCSEBH-QRRWFCJLSA-N |
| XLogP | 9.15 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.67 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|