C26H25F6N3O2 — CID 102599469
3-[3,5-bis(trifluoromethyl)anilino]-4-[[(2S)-1-phenyl-3-piperidin-1-ylpropan-2-yl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 102599469) has the molecular formula C26H25F6N3O2 and a molecular weight of 525.49 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)anilino]-4-[[(2S)-1-phenyl-3-piperidin-1-ylpropan-2-yl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[3,5-bis(trifluoromethyl)anilino]-4-[[(2S)-1-phenyl-3-piperidin-1-ylpropan-2-yl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 102599469 |
| Molecular Formula | C26H25F6N3O2 |
| Molecular Weight | 525.49 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)anilino]-4-[[(2S)-1-phenyl-3-piperidin-1-ylpropan-2-yl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(N[C@@H](Cc2ccccc2)CN2CCCCC2)c1=O |
| InChI | InChI=1S/C26H25F6N3O2/c27-25(28,29)17-12-18(26(30,31)32)14-19(13-17)33-21-22(24(37)23(21)36)34-20(11-16-7-3-1-4-8-16)15-35-9-5-2-6-10-35/h1,3-4,7-8,12-14,20,33-34H,2,5-6,9-11,15H2/t20-/m0/s1 |
| InChIKey | WVHXCCYXOQQBSM-FQEVSTJZSA-N |
| XLogP | 5.57 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|