C23H23F3O2 — CID 134951541
(5R,7R)-7-(2-phenylethyl)-9-(2,4,5-trifluorophenyl)-8-oxaspiro[4.5]decan-4-one (PubChem CID 134951541) has the molecular formula C23H23F3O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is (5R,7R)-7-(2-phenylethyl)-9-(2,4,5-trifluorophenyl)-8-oxaspiro[4.5]decan-4-one.
| Compound Name | (5R,7R)-7-(2-phenylethyl)-9-(2,4,5-trifluorophenyl)-8-oxaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 134951541 |
| Molecular Formula | C23H23F3O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | (5R,7R)-7-(2-phenylethyl)-9-(2,4,5-trifluorophenyl)-8-oxaspiro[4.5]decan-4-one |
| SMILES | O=C1CCC[C@@]12CC(c1cc(F)c(F)cc1F)O[C@H](CCc1ccccc1)C2 |
| InChI | InChI=1S/C23H23F3O2/c24-18-12-20(26)19(25)11-17(18)21-14-23(10-4-7-22(23)27)13-16(28-21)9-8-15-5-2-1-3-6-15/h1-3,5-6,11-12,16,21H,4,7-10,13-14H2/t16-,21?,23-/m1/s1 |
| InChIKey | YKOWLWXIBJOKAL-ONVWQOPBSA-N |
| XLogP | 5.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|