C18H21FO3 — CID 573406
1-(4-Fluorophenyl)-4,4-dimethyl-2-oxaspiro[5.5]undecane-3,5-dione (PubChem CID 573406) has the molecular formula C18H21FO3 and a molecular weight of 304.40 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4,4-dimethyl-2-oxaspiro[5.5]undecane-3,5-dione.
| Compound Name | 1-(4-Fluorophenyl)-4,4-dimethyl-2-oxaspiro[5.5]undecane-3,5-dione |
|---|---|
| PubChem CID | 573406 |
| Molecular Formula | C18H21FO3 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 1-(4-fluorophenyl)-4,4-dimethyl-2-oxaspiro[5.5]undecane-3,5-dione |
| SMILES | CC1(C(=O)C2(CCCCC2)C(OC1=O)C3=CC=C(C=C3)F)C |
| InChI | InChI=1S/C18H21FO3/c1-17(2)15(20)18(10-4-3-5-11-18)14(22-16(17)21)12-6-8-13(19)9-7-12/h6-9,14H,3-5,10-11H2,1-2H3 |
| InChIKey | GYPSTFUVVSHSCM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | 457 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|