C23H22O3 — CID 3365064
6-anthracen-9-yl-3,3,5,5-tetramethyloxane-2,4-dione (PubChem CID 3365064) has the molecular formula C23H22O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 6-anthracen-9-yl-3,3,5,5-tetramethyloxane-2,4-dione.
| Compound Name | 6-anthracen-9-yl-3,3,5,5-tetramethyloxane-2,4-dione |
|---|---|
| PubChem CID | 3365064 |
| Molecular Formula | C23H22O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 6-anthracen-9-yl-3,3,5,5-tetramethyloxane-2,4-dione |
| SMILES | CC1(C)C(=O)OC(c2c3ccccc3cc3ccccc23)C(C)(C)C1=O |
| InChI | InChI=1S/C23H22O3/c1-22(2)19(26-21(25)23(3,4)20(22)24)18-16-11-7-5-9-14(16)13-15-10-6-8-12-17(15)18/h5-13,19H,1-4H3 |
| InChIKey | LTEYFDRYYPZJAD-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|