C10H11ClO — CID 134952013
5-chloro-3,6-dimethyl-2,3-dihydro-1-benzofuran (PubChem CID 134952013) has the molecular formula C10H11ClO and a molecular weight of 182.65 g/mol. Its IUPAC name is 5-chloro-3,6-dimethyl-2,3-dihydro-1-benzofuran.
| Compound Name | 5-chloro-3,6-dimethyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 134952013 |
| Molecular Formula | C10H11ClO |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 5-chloro-3,6-dimethyl-2,3-dihydro-1-benzofuran |
| SMILES | Cc1cc2c(cc1Cl)C(C)CO2 |
| InChI | InChI=1S/C10H11ClO/c1-6-3-10-8(4-9(6)11)7(2)5-12-10/h3-4,7H,5H2,1-2H3 |
| InChIKey | RAGAMAZGZMELKI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |