C23H14N2S2 — CID 134952531
8,9-dithiophen-2-yl-11,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene (PubChem CID 134952531) has the molecular formula C23H14N2S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 8,9-dithiophen-2-yl-11,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene.
| Compound Name | 8,9-dithiophen-2-yl-11,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene |
|---|---|
| PubChem CID | 134952531 |
| Molecular Formula | C23H14N2S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 8,9-dithiophen-2-yl-11,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene |
| SMILES | c1csc(-c2c(-c3cccs3)c3c(nc4ccccn43)c3ccccc23)c1 |
| InChI | InChI=1S/C23H14N2S2/c1-2-8-16-15(7-1)20(17-9-5-13-26-17)21(18-10-6-14-27-18)23-22(16)24-19-11-3-4-12-25(19)23/h1-14H |
| InChIKey | MOTGZWLVFITFFS-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |