C15H15ClFN3O — CID 134952577
4-chloro-3-fluoro-8-(1-propoxyethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 134952577) has the molecular formula C15H15ClFN3O and a molecular weight of 307.76 g/mol. Its IUPAC name is 4-chloro-3-fluoro-8-(1-propoxyethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 4-chloro-3-fluoro-8-(1-propoxyethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 134952577 |
| Molecular Formula | C15H15ClFN3O |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 4-chloro-3-fluoro-8-(1-propoxyethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | CCCOC(C)n1c2cnc(Cl)c(F)c2c2cccnc21 |
| InChI | InChI=1S/C15H15ClFN3O/c1-3-7-21-9(2)20-11-8-19-14(16)13(17)12(11)10-5-4-6-18-15(10)20/h4-6,8-9H,3,7H2,1-2H3 |
| InChIKey | FSNNLUHITOOPQV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|