C13H13ClN6 — CID 16736116
6-chloro-9-[(3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine (PubChem CID 16736116) has the molecular formula C13H13ClN6 and a molecular weight of 288.74 g/mol. Its IUPAC name is 6-chloro-9-[(3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine.
| Compound Name | 6-chloro-9-[(3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine |
|---|---|
| PubChem CID | 16736116 |
| Molecular Formula | C13H13ClN6 |
| Molecular Weight | 288.74 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 6-chloro-9-[(3,5-dimethyl-2-pyridinyl)methyl]purin-2-amine |
| SMILES | Cc1cnc(Cn2cnc3c(Cl)nc(N)nc32)c(C)c1 |
| InChI | InChI=1S/C13H13ClN6/c1-7-3-8(2)9(16-4-7)5-20-6-17-10-11(14)18-13(15)19-12(10)20/h3-4,6H,5H2,1-2H3,(H2,15,18,19) |
| InChIKey | VMFMDUMCAGDUGD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.74 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |