C20H27NO6 — CID 134952938
9-O-tert-butyl 4-O-methyl (2R,4R)-2-methoxy-2-methyl-3,4,4a,9a-tetrahydropyrano[2,3-b]indole-4,9-dicarboxylate (PubChem CID 134952938) has the molecular formula C20H27NO6 and a molecular weight of 377.44 g/mol. Its IUPAC name is 9-O-tert-butyl 4-O-methyl (2R,4R)-2-methoxy-2-methyl-3,4,4a,9a-tetrahydropyrano[2,3-b]indole-4,9-dicarboxylate.
| Compound Name | 9-O-tert-butyl 4-O-methyl (2R,4R)-2-methoxy-2-methyl-3,4,4a,9a-tetrahydropyrano[2,3-b]indole-4,9-dicarboxylate |
|---|---|
| PubChem CID | 134952938 |
| Molecular Formula | C20H27NO6 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 9-O-tert-butyl 4-O-methyl (2R,4R)-2-methoxy-2-methyl-3,4,4a,9a-tetrahydropyrano[2,3-b]indole-4,9-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@](C)(OC)OC2C1c1ccccc1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H27NO6/c1-19(2,3)27-18(23)21-14-10-8-7-9-12(14)15-13(17(22)24-5)11-20(4,25-6)26-16(15)21/h7-10,13,15-16H,11H2,1-6H3/t13-,15?,16?,20-/m1/s1 |
| InChIKey | VKDVWMNXSVTCLB-WJDTXIQTSA-N |
| XLogP | 3.42 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |