C21H29NO5S — CID 134952942
9-O-tert-butyl 4-O-methyl (2S,4R)-2-ethylsulfanyl-2-methyl-3,4,4a,9a-tetrahydropyrano[2,3-b]indole-4,9-dicarboxylate (PubChem CID 134952942) has the molecular formula C21H29NO5S and a molecular weight of 407.53 g/mol. Its IUPAC name is 9-O-tert-butyl 4-O-methyl (2S,4R)-2-ethylsulfanyl-2-methyl-3,4,4a,9a-tetrahydropyrano[2,3-b]indole-4,9-dicarboxylate.
| Compound Name | 9-O-tert-butyl 4-O-methyl (2S,4R)-2-ethylsulfanyl-2-methyl-3,4,4a,9a-tetrahydropyrano[2,3-b]indole-4,9-dicarboxylate |
|---|---|
| PubChem CID | 134952942 |
| Molecular Formula | C21H29NO5S |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 9-O-tert-butyl 4-O-methyl (2S,4R)-2-ethylsulfanyl-2-methyl-3,4,4a,9a-tetrahydropyrano[2,3-b]indole-4,9-dicarboxylate |
| SMILES | CCS[C@@]1(C)C[C@@H](C(=O)OC)C2c3ccccc3N(C(=O)OC(C)(C)C)C2O1 |
| InChI | InChI=1S/C21H29NO5S/c1-7-28-21(5)12-14(18(23)25-6)16-13-10-8-9-11-15(13)22(17(16)26-21)19(24)27-20(2,3)4/h8-11,14,16-17H,7,12H2,1-6H3/t14-,16?,17?,21+/m1/s1 |
| InChIKey | YBUIXOKQHPQICA-QOHMJTHQSA-N |
| XLogP | 4.53 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |