C18H22O6 — CID 134953196
methyl (2S)-2-(4-acetyloxyphenyl)-4-ethoxy-5,5-dimethyl-2H-furan-3-carboxylate (PubChem CID 134953196) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is methyl (2S)-2-(4-acetyloxyphenyl)-4-ethoxy-5,5-dimethyl-2H-furan-3-carboxylate.
| Compound Name | methyl (2S)-2-(4-acetyloxyphenyl)-4-ethoxy-5,5-dimethyl-2H-furan-3-carboxylate |
|---|---|
| PubChem CID | 134953196 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | methyl (2S)-2-(4-acetyloxyphenyl)-4-ethoxy-5,5-dimethyl-2H-furan-3-carboxylate |
| SMILES | CCOC1=C(C(=O)OC)[C@H](c2ccc(OC(C)=O)cc2)OC1(C)C |
| InChI | InChI=1S/C18H22O6/c1-6-22-16-14(17(20)21-5)15(24-18(16,3)4)12-7-9-13(10-8-12)23-11(2)19/h7-10,15H,6H2,1-5H3/t15-/m0/s1 |
| InChIKey | DOCUNXHINIKRQR-HNNXBMFYSA-N |
| XLogP | 2.93 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|