C21H30O4 — CID 134953420
6-hydroxy-13,13-dimethoxy-5,5,9-trimethyltetracyclo[10.2.2.01,10.04,9]hexadeca-10,15-dien-14-one (PubChem CID 134953420) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is 6-hydroxy-13,13-dimethoxy-5,5,9-trimethyltetracyclo[10.2.2.01,10.04,9]hexadeca-10,15-dien-14-one.
| Compound Name | 6-hydroxy-13,13-dimethoxy-5,5,9-trimethyltetracyclo[10.2.2.01,10.04,9]hexadeca-10,15-dien-14-one |
|---|---|
| PubChem CID | 134953420 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 6-hydroxy-13,13-dimethoxy-5,5,9-trimethyltetracyclo[10.2.2.01,10.04,9]hexadeca-10,15-dien-14-one |
| SMILES | COC1(OC)C(=O)C23C=CC1C=C2C1(C)CCC(O)C(C)(C)C1CC3 |
| InChI | InChI=1S/C21H30O4/c1-18(2)14-7-11-20-10-6-13(21(24-4,25-5)17(20)23)12-15(20)19(14,3)9-8-16(18)22/h6,10,12-14,16,22H,7-9,11H2,1-5H3 |
| InChIKey | UYGNXLOSEHZYOB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|