C19H20O4S — CID 134953589
dimethyl 2-[(E,2R)-1-phenyl-4-thiophen-2-ylbut-3-en-2-yl]propanedioate (PubChem CID 134953589) has the molecular formula C19H20O4S and a molecular weight of 344.43 g/mol. Its IUPAC name is dimethyl 2-[(E,2R)-1-phenyl-4-thiophen-2-ylbut-3-en-2-yl]propanedioate.
| Compound Name | dimethyl 2-[(E,2R)-1-phenyl-4-thiophen-2-ylbut-3-en-2-yl]propanedioate |
|---|---|
| PubChem CID | 134953589 |
| Molecular Formula | C19H20O4S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | dimethyl 2-[(E,2R)-1-phenyl-4-thiophen-2-ylbut-3-en-2-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H](/C=C/c1cccs1)Cc1ccccc1 |
| InChI | InChI=1S/C19H20O4S/c1-22-18(20)17(19(21)23-2)15(10-11-16-9-6-12-24-16)13-14-7-4-3-5-8-14/h3-12,15,17H,13H2,1-2H3/b11-10+/t15-/m0/s1 |
| InChIKey | GXUMNFIOFPMEFX-NKSUMMKUSA-N |
| XLogP | 3.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|