C16H18N2O4 — CID 134953733
methyl (1R,5S)-5-hydroxy-13-oxo-2,12-diazatetracyclo[10.4.0.01,5.06,11]hexadeca-6,8,10-triene-2-carboxylate (PubChem CID 134953733) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is methyl (1R,5S)-5-hydroxy-13-oxo-2,12-diazatetracyclo[10.4.0.01,5.06,11]hexadeca-6,8,10-triene-2-carboxylate.
| Compound Name | methyl (1R,5S)-5-hydroxy-13-oxo-2,12-diazatetracyclo[10.4.0.01,5.06,11]hexadeca-6,8,10-triene-2-carboxylate |
|---|---|
| PubChem CID | 134953733 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | methyl (1R,5S)-5-hydroxy-13-oxo-2,12-diazatetracyclo[10.4.0.01,5.06,11]hexadeca-6,8,10-triene-2-carboxylate |
| SMILES | COC(=O)N1CC[C@]2(O)c3ccccc3N3C(=O)CCC[C@]132 |
| InChI | InChI=1S/C16H18N2O4/c1-22-14(20)17-10-9-15(21)11-5-2-3-6-12(11)18-13(19)7-4-8-16(15,17)18/h2-3,5-6,21H,4,7-10H2,1H3/t15-,16-/m0/s1 |
| InChIKey | NMMLEAKMNKODOZ-HOTGVXAUSA-N |
| XLogP | 1.57 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |