C19H24N2O2 — CID 78155425
15-ethyl-8-hydroxy-1,11-diazapentacyclo[9.7.1.02,7.08,19.015,19]nonadeca-2,4,6-trien-18-one (PubChem CID 78155425) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 15-ethyl-8-hydroxy-1,11-diazapentacyclo[9.7.1.02,7.08,19.015,19]nonadeca-2,4,6-trien-18-one.
| Compound Name | 15-ethyl-8-hydroxy-1,11-diazapentacyclo[9.7.1.02,7.08,19.015,19]nonadeca-2,4,6-trien-18-one |
|---|---|
| PubChem CID | 78155425 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 15-ethyl-8-hydroxy-1,11-diazapentacyclo[9.7.1.02,7.08,19.015,19]nonadeca-2,4,6-trien-18-one |
| SMILES | CCC12CCCN3CCC4(O)c5ccccc5N(C(=O)CC1)C324 |
| InChI | InChI=1S/C19H24N2O2/c1-2-17-9-5-12-20-13-11-18(23)14-6-3-4-7-15(14)21(19(17,18)20)16(22)8-10-17/h3-4,6-7,23H,2,5,8-13H2,1H3 |
| InChIKey | DUUKAPWRHRHNBO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |