C19H22N2O3 — CID 78156562
15-ethyl-9-hydroxy-1,11-diazapentacyclo[9.7.1.02,7.08,19.015,19]nonadeca-2,4,6-triene-10,18-dione (PubChem CID 78156562) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 15-ethyl-9-hydroxy-1,11-diazapentacyclo[9.7.1.02,7.08,19.015,19]nonadeca-2,4,6-triene-10,18-dione.
| Compound Name | 15-ethyl-9-hydroxy-1,11-diazapentacyclo[9.7.1.02,7.08,19.015,19]nonadeca-2,4,6-triene-10,18-dione |
|---|---|
| PubChem CID | 78156562 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 15-ethyl-9-hydroxy-1,11-diazapentacyclo[9.7.1.02,7.08,19.015,19]nonadeca-2,4,6-triene-10,18-dione |
| SMILES | CCC12CCCN3C(=O)C(O)C4c5ccccc5N(C(=O)CC1)C432 |
| InChI | InChI=1S/C19H22N2O3/c1-2-18-9-5-11-20-17(24)16(23)15-12-6-3-4-7-13(12)21(19(15,18)20)14(22)8-10-18/h3-4,6-7,15-16,23H,2,5,8-11H2,1H3 |
| InChIKey | IPLKUIIZTYHLIU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |