C14H13NO3 — CID 134844769
(6S,11S)-11-hydroxy-7-oxa-2-azatetracyclo[10.4.0.02,6.06,10]hexadeca-1(16),8,12,14-tetraen-3-one (PubChem CID 134844769) has the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. Its IUPAC name is (6S,11S)-11-hydroxy-7-oxa-2-azatetracyclo[10.4.0.02,6.06,10]hexadeca-1(16),8,12,14-tetraen-3-one.
| Compound Name | (6S,11S)-11-hydroxy-7-oxa-2-azatetracyclo[10.4.0.02,6.06,10]hexadeca-1(16),8,12,14-tetraen-3-one |
|---|---|
| PubChem CID | 134844769 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | (6S,11S)-11-hydroxy-7-oxa-2-azatetracyclo[10.4.0.02,6.06,10]hexadeca-1(16),8,12,14-tetraen-3-one |
| SMILES | O=C1CC[C@]23OC=CC2[C@H](O)c2ccccc2N13 |
| InChI | InChI=1S/C14H13NO3/c16-12-5-7-14-10(6-8-18-14)13(17)9-3-1-2-4-11(9)15(12)14/h1-4,6,8,10,13,17H,5,7H2/t10?,13-,14+/m1/s1 |
| InChIKey | ROQLXSHBIFXQPG-ADSMYIAOSA-N |
| XLogP | 1.72 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |