C19H24N2O — CID 134952791
(8S,15R,19S)-15-ethyl-1,11-diazapentacyclo[9.7.1.02,7.08,19.015,19]nonadeca-2,4,6-trien-18-one (PubChem CID 134952791) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is (8S,15R,19S)-15-ethyl-1,11-diazapentacyclo[9.7.1.02,7.08,19.015,19]nonadeca-2,4,6-trien-18-one.
| Compound Name | (8S,15R,19S)-15-ethyl-1,11-diazapentacyclo[9.7.1.02,7.08,19.015,19]nonadeca-2,4,6-trien-18-one |
|---|---|
| PubChem CID | 134952791 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | (8S,15R,19S)-15-ethyl-1,11-diazapentacyclo[9.7.1.02,7.08,19.015,19]nonadeca-2,4,6-trien-18-one |
| SMILES | CC[C@@]12CCCN3CC[C@H]4c5ccccc5N(C(=O)CC1)[C@]432 |
| InChI | InChI=1S/C19H24N2O/c1-2-18-10-5-12-20-13-9-15-14-6-3-4-7-16(14)21(19(15,18)20)17(22)8-11-18/h3-4,6-7,15H,2,5,8-13H2,1H3/t15-,18+,19-/m0/s1 |
| InChIKey | BUDRLZGHZYGRIQ-IPELMVKDSA-N |
| XLogP | 3.50 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |