C24H33N3O — CID 153284553
(1S,17S)-17-ethyl-20-pentyl-3,13,20-triazapentacyclo[11.7.0.01,17.02,10.04,9]icosa-2(10),4,6,8-tetraen-19-one (PubChem CID 153284553) has the molecular formula C24H33N3O and a molecular weight of 379.55 g/mol. Its IUPAC name is (1S,17S)-17-ethyl-20-pentyl-3,13,20-triazapentacyclo[11.7.0.01,17.02,10.04,9]icosa-2(10),4,6,8-tetraen-19-one.
| Compound Name | (1S,17S)-17-ethyl-20-pentyl-3,13,20-triazapentacyclo[11.7.0.01,17.02,10.04,9]icosa-2(10),4,6,8-tetraen-19-one |
|---|---|
| PubChem CID | 153284553 |
| Molecular Formula | C24H33N3O |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | (1S,17S)-17-ethyl-20-pentyl-3,13,20-triazapentacyclo[11.7.0.01,17.02,10.04,9]icosa-2(10),4,6,8-tetraen-19-one |
| SMILES | CCCCCN1C(=O)C[C@]2(CC)CCCN3CCc4c([nH]c5ccccc45)[C@@]312 |
| InChI | InChI=1S/C24H33N3O/c1-3-5-8-15-27-21(28)17-23(4-2)13-9-14-26-16-12-19-18-10-6-7-11-20(18)25-22(19)24(23,26)27/h6-7,10-11,25H,3-5,8-9,12-17H2,1-2H3/t23-,24+/m0/s1 |
| InChIKey | QVRVGWDRNLTMSU-BJKOFHAPSA-N |
| XLogP | 4.79 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|