C26H34N2O5 — CID 10895704
diethyl (17S)-17-ethyl-21-oxa-3,13-diazapentacyclo[11.8.0.01,17.02,10.04,9]henicosa-2(10),4,6,8-tetraene-19,19-dicarboxylate (PubChem CID 10895704) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is diethyl (17S)-17-ethyl-21-oxa-3,13-diazapentacyclo[11.8.0.01,17.02,10.04,9]henicosa-2(10),4,6,8-tetraene-19,19-dicarboxylate.
| Compound Name | diethyl (17S)-17-ethyl-21-oxa-3,13-diazapentacyclo[11.8.0.01,17.02,10.04,9]henicosa-2(10),4,6,8-tetraene-19,19-dicarboxylate |
|---|---|
| PubChem CID | 10895704 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | diethyl (17S)-17-ethyl-21-oxa-3,13-diazapentacyclo[11.8.0.01,17.02,10.04,9]henicosa-2(10),4,6,8-tetraene-19,19-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)COC23c4[nH]c5ccccc5c4CCN2CCC[C@@]3(CC)C1 |
| InChI | InChI=1S/C26H34N2O5/c1-4-24-13-9-14-28-15-12-19-18-10-7-8-11-20(18)27-21(19)26(24,28)33-17-25(16-24,22(29)31-5-2)23(30)32-6-3/h7-8,10-11,27H,4-6,9,12-17H2,1-3H3/t24-,26?/m0/s1 |
| InChIKey | DTASKFPCXARVKF-QSAPEBAKSA-N |
| XLogP | 3.90 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|