C19H23IN2O2 — CID 56649940
ethyl 2-[(Z)-2-iodobut-2-enyl]-1-methyl-4,9-dihydro-3H-pyrido[3,4-b]indole-1-carboxylate (PubChem CID 56649940) has the molecular formula C19H23IN2O2 and a molecular weight of 438.31 g/mol. Its IUPAC name is ethyl 2-[(Z)-2-iodobut-2-enyl]-1-methyl-4,9-dihydro-3H-pyrido[3,4-b]indole-1-carboxylate.
| Compound Name | ethyl 2-[(Z)-2-iodobut-2-enyl]-1-methyl-4,9-dihydro-3H-pyrido[3,4-b]indole-1-carboxylate |
|---|---|
| PubChem CID | 56649940 |
| Molecular Formula | C19H23IN2O2 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | ethyl 2-[(Z)-2-iodobut-2-enyl]-1-methyl-4,9-dihydro-3H-pyrido[3,4-b]indole-1-carboxylate |
| SMILES | C/C=C(\I)CN1CCc2c([nH]c3ccccc23)C1(C)C(=O)OCC |
| InChI | InChI=1S/C19H23IN2O2/c1-4-13(20)12-22-11-10-15-14-8-6-7-9-16(14)21-17(15)19(22,3)18(23)24-5-2/h4,6-9,21H,5,10-12H2,1-3H3/b13-4- |
| InChIKey | JFUVTLJLHIDPHE-PQMHYQBVSA-N |
| XLogP | 4.14 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|