C20H28N2 — CID 7078475
(2S,5R)-2-methyl-5-propyl-7,18-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),12,14,16-tetraene (PubChem CID 7078475) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is (2S,5R)-2-methyl-5-propyl-7,18-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),12,14,16-tetraene.
| Compound Name | (2S,5R)-2-methyl-5-propyl-7,18-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),12,14,16-tetraene |
|---|---|
| PubChem CID | 7078475 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | (2S,5R)-2-methyl-5-propyl-7,18-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),12,14,16-tetraene |
| SMILES | CCC[C@@H]1CC[C@@]2(C)c3[nH]c4ccccc4c3CCCN2C1 |
| InChI | InChI=1S/C20H28N2/c1-3-7-15-11-12-20(2)19-17(9-6-13-22(20)14-15)16-8-4-5-10-18(16)21-19/h4-5,8,10,15,21H,3,6-7,9,11-14H2,1-2H3/t15-,20+/m1/s1 |
| InChIKey | OWJXGLSBEBNLMI-QRWLVFNGSA-N |
| XLogP | 4.84 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |